ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-Difluorbutyrophenon |
|
Produkt-Name | 2,6-Difluorbutyrophenon |
Synonyme | 1-(2,6-Difluorphenyl)butan-1-on; |
Englischer Name | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
Molekulare Formel | C10H10F2O |
Molecular Weight | 184.1826 |
InChl | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
CAS Registry Number | 95727-77-8 |
Molecular Structure | ![]() |
Dichte | 1.134g/cm3 |
Siedepunkt | 219.6°C at 760 mmHg |
Brechungsindex | 1.472 |
Flammpunkt | 82.6°C |
Dampfdruck | 0.118mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |