ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-디플루오로부티로페논 |
|
상품명칭 | 2,6-디플루오로부티로페논 |
별명 | 1-(2,6-디플루오로페닐)부탄-1-온; |
영문 이름 | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
분자식 | C10H10F2O |
분자량 | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
cas번호 | 95727-77-8 |
분자 구조 | ![]() |
밀도 | 1.134g/cm3 |
비등점 | 219.6°C at 760 mmHg |
굴절 지수 | 1.472 |
인화점 | 82.6°C |
증기압 | 0.118mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |