ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-72-0 ethoxycarbonylmethyl ethyl phthalate |
|
| Chemical Name | ethoxycarbonylmethyl ethyl phthalate |
| Synonyms | Ethyl phthalyl ethyl glycolate;2-ethoxy-2-oxoethyl ethyl benzene-1,2-dicarboxylate |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.2732 |
| InChl | InChI=1/C14H16O6/c1-3-18-12(15)9-20-14(17)11-8-6-5-7-10(11)13(16)19-4-2/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number | 84-72-0 |
| EINECS | 201-555-3 |
| Molecular Structure | ![]() |
| Density | 1.194g/cm3 |
| Boiling Point | 374.1°C at 760 mmHg |
| Refractive Index | 1.509 |
| Flash Point | 163.8°C |
| Vapour Pressur | 8.56E-06mmHg at 25°C |
| MSDS | |