ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-72-0 ethoxycarbonylmethyl ethyl phthalate |
|
| Nama produk | ethoxycarbonylmethyl ethyl phthalate |
| Sinonim | ; Ethyl phthalyl ethyl glycolate; 2-ethoxy-2-oxoethyl benzene-1,2-dicarboxylate; |
| Nama Inggeris | ethoxycarbonylmethyl ethyl phthalate;Ethyl phthalyl ethyl glycolate;2-ethoxy-2-oxoethyl ethyl benzene-1,2-dicarboxylate |
| MF | C14H16O6 |
| Berat Molekul | 280.2732 |
| InChI | InChI=1/C14H16O6/c1-3-18-12(15)9-20-14(17)11-8-6-5-7-10(11)13(16)19-4-2/h5-8H,3-4,9H2,1-2H3 |
| CAS NO | 84-72-0 |
| EINECS | 201-555-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.194g/cm3 |
| Titik didih | 374.1°C at 760 mmHg |
| Indeks bias | 1.509 |
| Titik nyala | 163.8°C |
| Tekanan wap | 8.56E-06mmHg at 25°C |
| MSDS | |