ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-72-0 phtalate d’éthoxycarbonylméthyléthyle |
|
| Nom | phtalate d’éthoxycarbonylméthyléthyle |
| Synonymes | ; Glycolate d’éthyle phthalylique ; 2-éthoxy-2-oxoéthyléthylbenzène-1,2-dicarboxylate ; |
| Nom anglais | ethoxycarbonylmethyl ethyl phthalate;Ethyl phthalyl ethyl glycolate;2-ethoxy-2-oxoethyl ethyl benzene-1,2-dicarboxylate |
| Formule moléculaire | C14H16O6 |
| Poids Moléculaire | 280.2732 |
| InChl | InChI=1/C14H16O6/c1-3-18-12(15)9-20-14(17)11-8-6-5-7-10(11)13(16)19-4-2/h5-8H,3-4,9H2,1-2H3 |
| Numéro de registre CAS | 84-72-0 |
| EINECS | 201-555-3 |
| Structure moléculaire | ![]() |
| Densité | 1.194g/cm3 |
| Point d'ébullition | 374.1°C at 760 mmHg |
| Indice de réfraction | 1.509 |
| Point d'éclair | 163.8°C |
| Pression de vapeur | 8.56E-06mmHg at 25°C |
| MSDS | |