ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
124668-49-1 N,N-dimethylazetidin-3-amine dihydrochloride |
|
| Nom | N,N-dimethylazetidin-3-amine dihydrochloride |
| Nom anglais | N,N-dimethylazetidin-3-amine dihydrochloride;3-(Dimethylamino)azetidinedihydrochloride;3-Azetidinamine, N,N-dimethyl-, dihydrochloride;3-(Dimethylamino)azetidine 2HCl |
| Formule moléculaire | C5H14N2CL2 |
| Poids Moléculaire | 173.08556 |
| InChl | InChI=1/C5H12N2/c1-7(2)5-3-6-4-5/h5-6H,3-4H2,1-2H3 |
| Numéro de registre CAS | 124668-49-1 |
| Structure moléculaire | ![]() |
| Densité | 0.933g/cm3 |
| Point d'ébullition | 138.528°C at 760 mmHg |
| Indice de réfraction | 1.483 |
| Point d'éclair | 47.914°C |
| Pression de vapeur | 6.701mmHg at 25°C |
| MSDS | |