ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
148193-33-3 3-méthoxy-1,2-benzothiazol-6-amine |
|
| Nom | 3-méthoxy-1,2-benzothiazol-6-amine |
| Synonymes | 1,2-benzisothiazol-6-amine, 3-méthoxy- ; 3-méthoxy-1,2-benzothiazol-6-amine ; |
| Nom anglais | 3-methoxy-1,2-benzothiazol-6-amine;1,2-benzisothiazol-6-amine, 3-methoxy-;3-Methoxy-1,2-benzothiazol-6-amine |
| Formule moléculaire | C8H8N2OS |
| Poids Moléculaire | 180.2269 |
| InChl | InChI=1/C8H8N2OS/c1-11-8-6-3-2-5(9)4-7(6)12-10-8/h2-4H,9H2,1H3 |
| Numéro de registre CAS | 148193-33-3 |
| Structure moléculaire | ![]() |
| Densité | 1.359g/cm3 |
| Point d'ébullition | 264.8°C at 760 mmHg |
| Indice de réfraction | 1.704 |
| Point d'éclair | 113.9°C |
| Pression de vapeur | 0.00951mmHg at 25°C |
| MSDS | |