ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
148193-33-3 3-methoxy-1,2-benzothiazool-6-amine |
|
| Naam product | 3-methoxy-1,2-benzothiazool-6-amine |
| Synoniemen | ; 1,2-benzisothiazol-6-amine, 3-methoxy-; 3-methoxy-1,2-benzothiazol-6-amine; |
| Engelse naam | 3-methoxy-1,2-benzothiazol-6-amine;1,2-benzisothiazol-6-amine, 3-methoxy-;3-Methoxy-1,2-benzothiazol-6-amine |
| MF | C8H8N2OS |
| Molecuulgewicht | 180.2269 |
| InChI | InChI=1/C8H8N2OS/c1-11-8-6-3-2-5(9)4-7(6)12-10-8/h2-4H,9H2,1H3 |
| CAS-nummer | 148193-33-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.359g/cm3 |
| Kookpunt | 264.8°C at 760 mmHg |
| Brekingsindex | 1.704 |
| Vlampunt | 113.9°C |
| Dampdruk | 0.00951mmHg at 25°C |
| MSDS | |