ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid | 
    |
| Nom | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid | 
| Nom anglais | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid; | 
| Formule moléculaire | C11H11FO4 | 
| Poids Moléculaire | 226.20 | 
| InChl | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) | 
| Numéro de registre CAS | 347-63-7 | 
| EINECS | 206-474-7 | 
| Structure moléculaire | ![]()  | 
    
| Codes des risques | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Description de sécurité | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |