ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid | 
    |
| Nome del prodotto | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid | 
| Nome inglese | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid; | 
| Formula molecolare | C11H11FO4 | 
| Peso Molecolare | 226.20 | 
| InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) | 
| Numero CAS | 347-63-7 | 
| EINECS | 206-474-7 | 
| Struttura molecolare | ![]()  | 
    
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |