ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42075-32-1 pentane-1,1-diol |
|
| Nom | pentane-1,1-diol |
| Nom anglais | pentane-1,1-diol;(2R,4R)-(-)-PENTANEDIOL;(2S,4S)-(+)-Pentanediol;1,1-pentanediol;pentanediol |
| Formule moléculaire | C5H12O2 |
| Poids Moléculaire | 104.1476 |
| InChl | InChI=1/C5H12O2/c1-2-3-4-5(6)7/h5-7H,2-4H2,1H3 |
| Numéro de registre CAS | 42075-32-1;72345-23-4 |
| Structure moléculaire | ![]() |
| Densité | 0.978g/cm3 |
| Point d'ébullition | 174.021°C at 760 mmHg |
| Indice de réfraction | 1.443 |
| Point d'éclair | 72.784°C |
| Pression de vapeur | 0.384mmHg at 25°C |
| MSDS | |