ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42075-32-1 pentane-1,1-diol |
|
| Nome del prodotto | pentane-1,1-diol |
| Nome inglese | pentane-1,1-diol;(2R,4R)-(-)-PENTANEDIOL;(2S,4S)-(+)-Pentanediol;1,1-pentanediol;pentanediol |
| Formula molecolare | C5H12O2 |
| Peso Molecolare | 104.1476 |
| InChI | InChI=1/C5H12O2/c1-2-3-4-5(6)7/h5-7H,2-4H2,1H3 |
| Numero CAS | 42075-32-1;72345-23-4 |
| Struttura molecolare | ![]() |
| Densità | 0.978g/cm3 |
| Punto di ebollizione | 174.021°C at 760 mmHg |
| Indice di rifrazione | 1.443 |
| Punto d'infiammabilità | 72.784°C |
| Pressione di vapore | 0.384mmHg at 25°C |
| MSDS | |