ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
461-60-9 phosphorisothiocyanatidous difluoride |
|
| Nom | phosphorisothiocyanatidous difluoride |
| Nom anglais | phosphorisothiocyanatidous difluoride;Difluoroisothiocyanatophosphine |
| Formule moléculaire | CF2NPS |
| Poids Moléculaire | 127.053 |
| InChl | InChI=1/CF2NPS/c2-5(3)4-1-6 |
| Numéro de registre CAS | 461-60-9;461-68-7 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 79.8°C at 760 mmHg |
| Point d'éclair | 2.1°C |
| Pression de vapeur | 97mmHg at 25°C |
| MSDS | |