ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
461-60-9 phosphorisothiocyanatidous difluoride |
|
| Naam product | phosphorisothiocyanatidous difluoride |
| Engelse naam | phosphorisothiocyanatidous difluoride;Difluoroisothiocyanatophosphine |
| MF | CF2NPS |
| Molecuulgewicht | 127.053 |
| InChI | InChI=1/CF2NPS/c2-5(3)4-1-6 |
| CAS-nummer | 461-60-9;461-68-7 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 79.8°C at 760 mmHg |
| Vlampunt | 2.1°C |
| Dampdruk | 97mmHg at 25°C |
| MSDS | |