ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54381-08-7 4-Hydroxy-2'-Nitro Diphenylamine |
|
| Nom | 4-Hydroxy-2'-Nitro Diphenylamine |
| Nom anglais | 4-Hydroxy-2'-Nitro Diphenylamine;4-Hydroxy-2-Nitrodiphenylamine;4-[(2-nitrophenyl)amino]phenol;4-Hydroxy-2'-nitrodiphenylamine;HC Orange No.1;Hc Orange 1;2-Nitro-4'-hydroxydiphenylamine |
| Formule moléculaire | C12H10N2O3 |
| Poids Moléculaire | 230.2194 |
| InChl | InChI=1/C12H10N2O3/c15-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(16)17/h1-8,13,15H |
| Numéro de registre CAS | 54381-08-7 |
| EINECS | 259-132-4 |
| Structure moléculaire | ![]() |
| Densité | 1.388g/cm3 |
| Point d'ébullition | 384.9°C at 760 mmHg |
| Indice de réfraction | 1.699 |
| Point d'éclair | 186.6°C |
| Pression de vapeur | 1.79E-06mmHg at 25°C |
| MSDS | |