ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54381-08-7 4-Hydroxy-2'-Nitro Diphenylamine |
|
| Nome del prodotto | 4-Hydroxy-2'-Nitro Diphenylamine |
| Nome inglese | 4-Hydroxy-2'-Nitro Diphenylamine;4-Hydroxy-2-Nitrodiphenylamine;4-[(2-nitrophenyl)amino]phenol;4-Hydroxy-2'-nitrodiphenylamine;HC Orange No.1;Hc Orange 1;2-Nitro-4'-hydroxydiphenylamine |
| Formula molecolare | C12H10N2O3 |
| Peso Molecolare | 230.2194 |
| InChI | InChI=1/C12H10N2O3/c15-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(16)17/h1-8,13,15H |
| Numero CAS | 54381-08-7 |
| EINECS | 259-132-4 |
| Struttura molecolare | ![]() |
| Densità | 1.388g/cm3 |
| Punto di ebollizione | 384.9°C at 760 mmHg |
| Indice di rifrazione | 1.699 |
| Punto d'infiammabilità | 186.6°C |
| Pressione di vapore | 1.79E-06mmHg at 25°C |
| MSDS | |