ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56360-46-4 4',5'-dibromo-2',7'-dinitro-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthène]-3',6'-diolate |
|
| Nom | 4',5'-dibromo-2',7'-dinitro-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthène]-3',6'-diolate |
| Synonymes | ; |
| Nom anglais | 4',5'-dibromo-2',7'-dinitro-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate; |
| Formule moléculaire | C20H6Br2N2O9 |
| Poids Moléculaire | 578.0787 |
| InChl | InChI=1/C20H8Br2N2O9/c21-13-15(25)11(23(28)29)5-9-17(13)32-18-10(6-12(24(30)31)16(26)14(18)22)20(9)8-4-2-1-3-7(8)19(27)33-20/h1-6,25-26H/p-2 |
| Numéro de registre CAS | 56360-46-4 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 663.6°C at 760 mmHg |
| Point d'éclair | 355.1°C |
| Pression de vapeur | 3.22E-18mmHg at 25°C |
| MSDS | |