ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56360-46-4 4',5'-dibróm-2',7'-dinitro-3-oxo-3H-spiro[2-benzofurán-1,9'-xantén]-3',6'-diolát |
|
| termék neve | 4',5'-dibróm-2',7'-dinitro-3-oxo-3H-spiro[2-benzofurán-1,9'-xantén]-3',6'-diolát |
| Szinonimák | ; |
| Angol név | 4',5'-dibromo-2',7'-dinitro-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate; |
| MF | C20H6Br2N2O9 |
| Molekulatömeg | 578.0787 |
| InChI | InChI=1/C20H8Br2N2O9/c21-13-15(25)11(23(28)29)5-9-17(13)32-18-10(6-12(24(30)31)16(26)14(18)22)20(9)8-4-2-1-3-7(8)19(27)33-20/h1-6,25-26H/p-2 |
| CAS-szám | 56360-46-4 |
| Molekuláris szerkezete | ![]() |
| Forráspont | 663.6°C at 760 mmHg |
| Gyulladáspont | 355.1°C |
| Gőznyomás | 3.22E-18mmHg at 25°C |
| MSDS | |