ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58578-45-3 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester |
|
| Nom | 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester |
| Nom anglais | 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester;Benzyl 2-{[(benzyloxy)carbonyl]amino}-4-oxobutanoate;butanoic acid, 4-oxo-2-[[(phenylmethoxy)carbonyl]amino]-, phenylmethyl ester |
| Formule moléculaire | C19H19NO5 |
| Poids Moléculaire | 341.3579 |
| InChl | InChI=1/C19H19NO5/c21-12-11-17(18(22)24-13-15-7-3-1-4-8-15)20-19(23)25-14-16-9-5-2-6-10-16/h1-10,12,17H,11,13-14H2,(H,20,23) |
| Numéro de registre CAS | 58578-45-3 |
| Structure moléculaire | ![]() |
| Densité | 1.223g/cm3 |
| Point de fusion | 80.5-82℃ |
| Point d'ébullition | 534.1°C at 760 mmHg |
| Indice de réfraction | 1.564 |
| Point d'éclair | 276.8°C |
| Pression de vapeur | 1.74E-11mmHg at 25°C |
| MSDS | |