ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58578-45-3 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester |
|
| Nome del prodotto | 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester |
| Nome inglese | 4-oxo-2S-[[(phenymethyoxy)carbonyl]amino]-butyric acid phenymethyl ester;Benzyl 2-{[(benzyloxy)carbonyl]amino}-4-oxobutanoate;butanoic acid, 4-oxo-2-[[(phenylmethoxy)carbonyl]amino]-, phenylmethyl ester |
| Formula molecolare | C19H19NO5 |
| Peso Molecolare | 341.3579 |
| InChI | InChI=1/C19H19NO5/c21-12-11-17(18(22)24-13-15-7-3-1-4-8-15)20-19(23)25-14-16-9-5-2-6-10-16/h1-10,12,17H,11,13-14H2,(H,20,23) |
| Numero CAS | 58578-45-3 |
| Struttura molecolare | ![]() |
| Densità | 1.223g/cm3 |
| Punto di fusione | 80.5-82℃ |
| Punto di ebollizione | 534.1°C at 760 mmHg |
| Indice di rifrazione | 1.564 |
| Punto d'infiammabilità | 276.8°C |
| Pressione di vapore | 1.74E-11mmHg at 25°C |
| MSDS | |