ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-39-4 1,4-dimethoxy-2-nitrobenzene |
|
| Nom | 1,4-dimethoxy-2-nitrobenzene |
| Nom anglais | 1,4-dimethoxy-2-nitrobenzene;Benzene, 1,4-dimethoxy-2-nitro-;2,5-Dimethoxynitrobenzene;AI3-24179;NSC 1321 |
| Formule moléculaire | C8H9NO4 |
| Poids Moléculaire | 183.1614 |
| InChl | InChI=1/C8H9NO4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3 |
| Numéro de registre CAS | 89-39-4 |
| EINECS | 201-903-4 |
| Structure moléculaire | ![]() |
| Densité | 1.226g/cm3 |
| Point d'ébullition | 317.9°C at 760 mmHg |
| Indice de réfraction | 1.53 |
| Point d'éclair | 156.7°C |
| Pression de vapeur | 0.000698mmHg at 25°C |
| MSDS | |