ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-39-4 1,4-dimethoxy-2-nitrobenzene |
|
| Nome del prodotto | 1,4-dimethoxy-2-nitrobenzene |
| Nome inglese | 1,4-dimethoxy-2-nitrobenzene;Benzene, 1,4-dimethoxy-2-nitro-;2,5-Dimethoxynitrobenzene;AI3-24179;NSC 1321 |
| Formula molecolare | C8H9NO4 |
| Peso Molecolare | 183.1614 |
| InChI | InChI=1/C8H9NO4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3 |
| Numero CAS | 89-39-4 |
| EINECS | 201-903-4 |
| Struttura molecolare | ![]() |
| Densità | 1.226g/cm3 |
| Punto di ebollizione | 317.9°C at 760 mmHg |
| Indice di rifrazione | 1.53 |
| Punto d'infiammabilità | 156.7°C |
| Pressione di vapore | 0.000698mmHg at 25°C |
| MSDS | |