ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
892501-94-9 4-(4-isocyanatophénoxy)tétrahydropyrane |
|
| Nom | 4-(4-isocyanatophénoxy)tétrahydropyrane |
| Nom anglais | 4-(4-isocyanatophenoxy)tetrahydropyran; |
| Formule moléculaire | C12H13NO3 |
| Poids Moléculaire | 219.2365 |
| InChl | InChI=1/C12H13NO3/c14-9-13-10-1-3-11(4-2-10)16-12-5-7-15-8-6-12/h1-4,12H,5-8H2 |
| Numéro de registre CAS | 892501-94-9 |
| Structure moléculaire | ![]() |
| Densité | 1.19g/cm3 |
| Point d'ébullition | 340°C at 760 mmHg |
| Indice de réfraction | 1.56 |
| Point d'éclair | 156.8°C |
| Pression de vapeur | 8.84E-05mmHg at 25°C |
| MSDS | |