ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
892501-94-9 4-(4-isocyanatofenoxy)tetrahydropyran |
|
| Naam product | 4-(4-isocyanatofenoxy)tetrahydropyran |
| Engelse naam | 4-(4-isocyanatophenoxy)tetrahydropyran; |
| MF | C12H13NO3 |
| Molecuulgewicht | 219.2365 |
| InChI | InChI=1/C12H13NO3/c14-9-13-10-1-3-11(4-2-10)16-12-5-7-15-8-6-12/h1-4,12H,5-8H2 |
| CAS-nummer | 892501-94-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.19g/cm3 |
| Kookpunt | 340°C at 760 mmHg |
| Brekingsindex | 1.56 |
| Vlampunt | 156.8°C |
| Dampdruk | 8.84E-05mmHg at 25°C |
| MSDS | |