ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 100-80-1 m-Vinyltoluene | |
| Ονομασία του προϊόντος | m-Vinyltoluene | 
| Αγγλικό όνομα | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene | 
| MF | C9H10 | 
| Μοριακό βάρος | 118.17 | 
| InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 | 
| CAS ΟΧΙ | 100-80-1 | 
| EINECS | 202-889-2 | 
| Μοριακή δομή |  | 
| Πυκνότητα | 170 | 
| Σημείο βρασμού | 171℃ | 
| Κινδύνου Κώδικες | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |