ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 100-80-1 m-Vinyltoluene | |
| Nome do produto | m-Vinyltoluene | 
| Nome em inglês | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene | 
| Fórmula molecular | C9H10 | 
| Peso Molecular | 118.17 | 
| InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 | 
| CAS Registry Number | 100-80-1 | 
| EINECS | 202-889-2 | 
| Estrutura Molecular |  | 
| Densidade | 170 | 
| Ponto de ebulição | 171℃ | 
| Códigos de risco | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |