ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25101-03-5 Hexanedioic acid, polymer with 1,2-Propanediol |
|
Ονομασία του προϊόντος | Hexanedioic acid, polymer with 1,2-Propanediol |
Αγγλικό όνομα | Hexanedioic acid, polymer with 1,2-Propanediol;Poly(propylene adipate);Poly(1,2-propylene glycol adipate);Poly(propylene glycol adipate);Propylene glycol, adipic acid resin;hexanedioic acid-propane-1,2-diol (1:1) |
MF | C9H18O6 |
Μοριακό βάρος | 222.2356 |
InChI | InChI=1/C6H10O4.C3H8O2/c7-5(8)3-1-2-4-6(9)10;1-3(5)2-4/h1-4H2,(H,7,8)(H,9,10);3-5H,2H2,1H3 |
CAS ΟΧΙ | 25101-03-5 |
Μοριακή δομή | ![]() |
Σημείο βρασμού | 338.5°C at 760 mmHg |
Σημείο ανάφλεξης | 172.7°C |
Πίεση ατμών | 1.81E-05mmHg at 25°C |
MSDS |