Chemindex > 25101-03-5
NO ▼
25101-03-5 Hexanedioic acid, polymer with 1,2-Propanediol |
|
| produktnavn | Hexanedioic acid, polymer with 1,2-Propanediol |
| Engelsk navn | Hexanedioic acid, polymer with 1,2-Propanediol;Poly(propylene adipate);Poly(1,2-propylene glycol adipate);Poly(propylene glycol adipate);Propylene glycol, adipic acid resin;hexanedioic acid-propane-1,2-diol (1:1) |
| Molekylær Formel | C9H18O6 |
| Molekylvekt | 222.2356 |
| InChI | InChI=1/C6H10O4.C3H8O2/c7-5(8)3-1-2-4-6(9)10;1-3(5)2-4/h1-4H2,(H,7,8)(H,9,10);3-5H,2H2,1H3 |
| CAS-nummer | 25101-03-5 |
| Molecular Structure |  |
| Kokepunkt | 338.5°C at 760 mmHg |
| Flammepunktet | 172.7°C |
| Damptrykk | 1.81E-05mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 25101-03-5 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 