ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-69-5 Orphenadrine hydrochloride |
|
| Ονομασία του προϊόντος | Orphenadrine hydrochloride |
| Αγγλικό όνομα | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| MF | C18H24NO |
| Μοριακό βάρος | 270.3887 |
| InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| CAS ΟΧΙ | 341-69-5 |
| EINECS | 206-435-4 |
| Μοριακή δομή | ![]() |
| Σημείο τήξης | 159-162℃ |
| Σημείο βρασμού | 363°C at 760 mmHg |
| Σημείο ανάφλεξης | 107.1°C |
| Πίεση ατμών | 1.86E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R20/21##Harmful by inhalation and in contact with skin.:; |
| Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.:; |
| MSDS | |