ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-69-5 Orphenadrine hydrochloride | 
    |
| termék neve | Orphenadrine hydrochloride | 
| Angol név | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium | 
| MF | C18H24NO | 
| Molekulatömeg | 270.3887 | 
| InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 | 
| CAS-szám | 341-69-5 | 
| EINECS | 206-435-4 | 
| Molekuláris szerkezete | ![]()  | 
    
| Olvadáspont | 159-162℃ | 
| Forráspont | 363°C at 760 mmHg | 
| Gyulladáspont | 107.1°C | 
| Gőznyomás | 1.86E-05mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R20/21##Harmful by inhalation and in contact with skin.:; | 
    
| Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.:; | 
    
| MSDS | |