ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-13-4 1,3-difluoro-2-propanol |
|
| Ονομασία του προϊόντος | 1,3-difluoro-2-propanol |
| Αγγλικό όνομα | 1,3-difluoro-2-propanol;Geiftor;1,3-difluoropropan-2-one |
| MF | C3H4F2O |
| Μοριακό βάρος | 94.0601 |
| InChI | InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2 |
| CAS ΟΧΙ | 453-13-4 |
| EINECS | 207-216-6 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.092g/cm3 |
| Σημείο βρασμού | 85.7°C at 760 mmHg |
| Δείκτης διάθλασης | 1.304 |
| Σημείο ανάφλεξης | 22°C |
| Πίεση ατμών | 68.5mmHg at 25°C |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R10##Flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Περιγραφή της ασφάλειας | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |