ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-13-4 1,3-difluoro-2-propanol |
|
| उत्पाद का नाम | 1,3-difluoro-2-propanol |
| अंग्रेज | 1,3-difluoro-2-propanol;Geiftor;1,3-difluoropropan-2-one |
| आणविक फार्मूला | C3H4F2O |
| आण्विक वजन | 94.0601 |
| InChI | InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2 |
| कैस रजिस्टी संख्या | 453-13-4 |
| EINECS | 207-216-6 |
| आणविक संरचना | ![]() |
| घनत्व | 1.092g/cm3 |
| उबलने का समय | 85.7°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.304 |
| फ्लैश प्वाइंट | 22°C |
| वाष्प का दबाव | 68.5mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R10##Flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |