ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51317-66-9 4-morpholinophenyl isothiocyanate |
|
| Ονομασία του προϊόντος | 4-morpholinophenyl isothiocyanate |
| Αγγλικό όνομα | 4-morpholinophenyl isothiocyanate;4-(4-isothiocyanatophenyl)morpholine |
| MF | C11H12N2OS |
| Μοριακό βάρος | 220.2908 |
| InChI | InChI=1/C11H12N2OS/c15-9-12-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-8H2 |
| CAS ΟΧΙ | 51317-66-9 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.2g/cm3 |
| Σημείο βρασμού | 394.4°C at 760 mmHg |
| Δείκτης διάθλασης | 1.613 |
| Σημείο ανάφλεξης | 192.3°C |
| Πίεση ατμών | 1.99E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |