Chemindex > 51317-66-9
NO ▼
51317-66-9 4-morpholinophenyl isothiocyanate |
|
| produktnavn | 4-morpholinophenyl isothiocyanate |
| Engelsk navn | 4-morpholinophenyl isothiocyanate;4-(4-isothiocyanatophenyl)morpholine |
| Molekylær Formel | C11H12N2OS |
| Molekylvekt | 220.2908 |
| InChI | InChI=1/C11H12N2OS/c15-9-12-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-8H2 |
| CAS-nummer | 51317-66-9 |
| Molecular Structure |  |
| Tetthet | 1.2g/cm3 |
| Kokepunkt | 394.4°C at 760 mmHg |
| Brytningsindeks | 1.613 |
| Flammepunktet | 192.3°C |
| Damptrykk | 1.99E-06mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 51317-66-9 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 