ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-69-6 Martius Yellow |
|
| Ονομασία του προϊόντος | Martius Yellow |
| Αγγλικό όνομα | Martius Yellow;C.I. 10315;Martius yellow;2,4-Dinitro-1-naphthol;Acid Yellow 24;C.I. 10315~Martius Yellow;2,4-dinitronaphthalen-1-ol;2,4-dinitronaphthalen-1-olate |
| MF | C10H5N2O5 |
| Μοριακό βάρος | 233.1576 |
| InChI | InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
| CAS ΟΧΙ | 605-69-6 |
| EINECS | 210-093-1 |
| Μοριακή δομή | ![]() |
| Σημείο τήξης | 130-133℃ |
| Σημείο βρασμού | 407.9°C at 760 mmHg |
| Σημείο ανάφλεξης | 179.9°C |
| Πίεση ατμών | 3.08E-07mmHg at 25°C |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Περιγραφή της ασφάλειας | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |