Chemindex > 605-69-6
KR ▼
605-69-6 Martius Yellow |
|
| 상품명칭 | Martius Yellow |
| 영문 이름 | Martius Yellow;C.I. 10315;Martius yellow;2,4-Dinitro-1-naphthol;Acid Yellow 24;C.I. 10315~Martius Yellow;2,4-dinitronaphthalen-1-ol;2,4-dinitronaphthalen-1-olate |
| 분자식 | C10H5N2O5 |
| 분자량 | 233.1576 |
| InChI | InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
| cas번호 | 605-69-6 |
| EC번호 | 210-093-1 |
| 분자 구조 |  |
| 녹는 점 | 130-133℃ |
| 비등점 | 407.9°C at 760 mmHg |
| 인화점 | 179.9°C |
| 증기압 | 3.08E-07mmHg at 25°C |
| 위험성 표시 |  T##Toxic:; |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 