ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-97-1 phthalamic acid |
|
| Ονομασία του προϊόντος | phthalamic acid |
| Αγγλικό όνομα | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
| MF | C8H7NO3 |
| Μοριακό βάρος | 165.1461 |
| InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| CAS ΟΧΙ | 88-97-1 |
| EINECS | 201-871-1 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.368g/cm3 |
| Σημείο βρασμού | 394.2°C at 760 mmHg |
| Δείκτης διάθλασης | 1.615 |
| Σημείο ανάφλεξης | 192.2°C |
| Πίεση ατμών | 6.38E-07mmHg at 25°C |
| Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |