ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-97-1 phthalamic acid |
|
| نام محصول | phthalamic acid |
| نام انگلیسی | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
| میدان مغناطیسی | C8H7NO3 |
| وزن مولکولی | 165.1461 |
| InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| شماره سیایاس | 88-97-1 |
| تعداد کمیسیون اروپایی | 201-871-1 |
| ساختار مولکولی | ![]() |
| تراکم | 1.368g/cm3 |
| نقطه غلیان | 394.2°C at 760 mmHg |
| ضریب شکست | 1.615 |
| نقطه اشتعال | 192.2°C |
| فشار بخار | 6.38E-07mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |