ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
154464-26-3 3-(ciklopentiloxi)-4-metoxianilin |
|
termék neve | 3-(ciklopentiloxi)-4-metoxianilin |
Angol név | 3-(cyclopentyloxy)-4-methoxyaniline; |
MF | C12H17NO2 |
Molekulatömeg | 207.2689 |
InChI | InChI=1/C12H17NO2/c1-14-11-7-6-9(13)8-12(11)15-10-4-2-3-5-10/h6-8,10H,2-5,13H2,1H3 |
CAS-szám | 154464-26-3 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.123g/cm3 |
Forráspont | 342.6°C at 760 mmHg |
Törésmutató | 1.567 |
Gyulladáspont | 176.5°C |
Gőznyomás | 7.44E-05mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |