ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
154464-26-3 3-(시클로펜틸옥시)-4-메톡시아닐린 |
|
상품명칭 | 3-(시클로펜틸옥시)-4-메톡시아닐린 |
영문 이름 | 3-(cyclopentyloxy)-4-methoxyaniline; |
분자식 | C12H17NO2 |
분자량 | 207.2689 |
InChI | InChI=1/C12H17NO2/c1-14-11-7-6-9(13)8-12(11)15-10-4-2-3-5-10/h6-8,10H,2-5,13H2,1H3 |
cas번호 | 154464-26-3 |
분자 구조 | ![]() |
밀도 | 1.123g/cm3 |
비등점 | 342.6°C at 760 mmHg |
굴절 지수 | 1.567 |
인화점 | 176.5°C |
증기압 | 7.44E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |