ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1643-28-3 3-(2-Chlorophenyl)propionic acid |
|
termék neve | 3-(2-Chlorophenyl)propionic acid |
Angol név | 3-(2-Chlorophenyl)propionic acid;Benzenepropanoic acid, 2-chloro-;2-Chlorobenzenepropanoic acid;3-(2-chlorophenyl)propanoic acid;3-(2-chlorophenyl)propanoate |
MF | C9H8ClO2 |
Molekulatömeg | 183.6122 |
InChI | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
CAS-szám | 1643-28-3 |
Molekuláris szerkezete | ![]() |
Forráspont | 306.6°C at 760 mmHg |
Gyulladáspont | 139.2°C |
Gőznyomás | 0.000333mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |