ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1643-28-3 3-(2-Chlorophenyl)propionic acid |
|
상품명칭 | 3-(2-Chlorophenyl)propionic acid |
영문 이름 | 3-(2-Chlorophenyl)propionic acid;Benzenepropanoic acid, 2-chloro-;2-Chlorobenzenepropanoic acid;3-(2-chlorophenyl)propanoic acid;3-(2-chlorophenyl)propanoate |
분자식 | C9H8ClO2 |
분자량 | 183.6122 |
InChI | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
cas번호 | 1643-28-3 |
분자 구조 | ![]() |
비등점 | 306.6°C at 760 mmHg |
인화점 | 139.2°C |
증기압 | 0.000333mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |