ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
212779-19-6 2,3,5-Trichlorobenzeneboronic acid |
|
| termék neve | 2,3,5-Trichlorobenzeneboronic acid |
| Angol név | 2,3,5-Trichlorobenzeneboronic acid;Thiocarbamoylhydrazine;(2,3,5-trichlorophenyl)boronic acid;Boronic acid,B-(2,3,5-trichlorophenyl)-;2,3,5-Trichlorophenylboronic acid |
| MF | C6H4BCl3O2 |
| Molekulatömeg | 225.2648 |
| InChI | InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| CAS-szám | 212779-19-6 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.6g/cm3 |
| Forráspont | 383.4°C at 760 mmHg |
| Törésmutató | 1.594 |
| Gyulladáspont | 185.7°C |
| Gőznyomás | 1.46E-06mmHg at 25°C |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |