ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
212779-19-6 2,3,5-Trichlorobenzeneboronic acid |
|
| उत्पाद का नाम | 2,3,5-Trichlorobenzeneboronic acid |
| अंग्रेज | 2,3,5-Trichlorobenzeneboronic acid;Thiocarbamoylhydrazine;(2,3,5-trichlorophenyl)boronic acid;Boronic acid,B-(2,3,5-trichlorophenyl)-;2,3,5-Trichlorophenylboronic acid |
| आणविक फार्मूला | C6H4BCl3O2 |
| आण्विक वजन | 225.2648 |
| InChI | InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| कैस रजिस्टी संख्या | 212779-19-6 |
| आणविक संरचना | ![]() |
| घनत्व | 1.6g/cm3 |
| उबलने का समय | 383.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.594 |
| फ्लैश प्वाइंट | 185.7°C |
| वाष्प का दबाव | 1.46E-06mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |