ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
213462-19-2 4-(4-metoxifenil)-4,5,6,7-tetrahidrotién[3,2-c]piridin |
|
| termék neve | 4-(4-metoxifenil)-4,5,6,7-tetrahidrotién[3,2-c]piridin |
| Angol név | 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine; |
| MF | C14H15NOS |
| Molekulatömeg | 245.34 |
| InChI | InChI=1/C14H15NOS/c1-16-11-4-2-10(3-5-11)14-12-7-9-17-13(12)6-8-15-14/h2-5,7,9,14-15H,6,8H2,1H3 |
| CAS-szám | 213462-19-2 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.168g/cm3 |
| Olvadáspont | 67℃ |
| Forráspont | 383.4°C at 760 mmHg |
| Törésmutató | 1.594 |
| Gyulladáspont | 185.7°C |
| Gőznyomás | 4.41E-06mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |