ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
213462-19-2 4- (4-metoksifenil) -4,5,6,7-tetrahidrotieno [3,2-c] piridin |
|
| Ürün Adı | 4- (4-metoksifenil) -4,5,6,7-tetrahidrotieno [3,2-c] piridin |
| Eş anlamlı | |
| ingilizce adı | 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine; |
| Moleküler Formülü | C14H15NOS |
| Molekül Ağırlığı | 245.34 |
| InChI | InChI=1/C14H15NOS/c1-16-11-4-2-10(3-5-11)14-12-7-9-17-13(12)6-8-15-14/h2-5,7,9,14-15H,6,8H2,1H3 |
| CAS kayıt numarası | 213462-19-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.168g/cm3 |
| Ergime noktası | 67℃ |
| Kaynama noktası | 383.4°C at 760 mmHg |
| Kırılma indisi | 1.594 |
| Alevlenme noktası | 185.7°C |
| Buhar basıncı | 4.41E-06mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |