ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
486-70-4 lupinine |
|
termék neve | lupinine |
Angol név | lupinine;(-)-Lupinine;(1R-trans)-Octahydro-2H-quinolizine-1-methanol;(1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol;(1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
MF | C10H19NO |
Molekulatömeg | 169.264 |
InChI | InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
CAS-szám | 486-70-4 |
EINECS | 207-638-0 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.04g/cm3 |
Olvadáspont | 68-69℃ |
Forráspont | 270°C at 760 mmHg |
Törésmutató | 1.525 |
Gyulladáspont | 99.1°C |
Gőznyomás | 0.000928mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |