ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
486-70-4 lupinine |
|
상품명칭 | lupinine |
영문 이름 | lupinine;(-)-Lupinine;(1R-trans)-Octahydro-2H-quinolizine-1-methanol;(1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol;(1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
분자식 | C10H19NO |
분자량 | 169.264 |
InChI | InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
cas번호 | 486-70-4 |
EC번호 | 207-638-0 |
분자 구조 | ![]() |
밀도 | 1.04g/cm3 |
녹는 점 | 68-69℃ |
비등점 | 270°C at 760 mmHg |
굴절 지수 | 1.525 |
인화점 | 99.1°C |
증기압 | 0.000928mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |