ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4919-33-9 4-Ethoxyphenylacetic acid |
|
termék neve | 4-Ethoxyphenylacetic acid |
Angol név | 4-Ethoxyphenylacetic acid;Benzeneacetic acid, 4-ethoxy-;(4-ethoxyphenyl)acetate |
MF | C10H11O3 |
Molekulatömeg | 179.1931 |
InChI | InChI=1/C10H12O3/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)/p-1 |
CAS-szám | 4919-33-9 |
EINECS | 225-545-3 |
Molekuláris szerkezete | ![]() |
Olvadáspont | 86-90℃ |
Forráspont | 318.5°C at 760 mmHg |
Gyulladáspont | 125.8°C |
Gőznyomás | 0.000151mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |