ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4919-33-9 4-Ethoxyphenylacetic acid |
|
produktnavn | 4-Ethoxyphenylacetic acid |
Engelsk navn | 4-Ethoxyphenylacetic acid;Benzeneacetic acid, 4-ethoxy-;(4-ethoxyphenyl)acetate |
Molekylær Formel | C10H11O3 |
Molekylvekt | 179.1931 |
InChI | InChI=1/C10H12O3/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)/p-1 |
CAS-nummer | 4919-33-9 |
EINECS | 225-545-3 |
Molecular Structure | ![]() |
Smeltepunkt | 86-90℃ |
Kokepunkt | 318.5°C at 760 mmHg |
Flammepunktet | 125.8°C |
Damptrykk | 0.000151mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |